C23H28N4O2 — CID 131937778
N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide (PubChem CID 131937778) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide.
| Compound Name | N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 131937778 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide |
| SMILES | O=C(NC1C2CN3CCN(C2)CC1(c1ccccc1)C3)c1onc2c1CCCC2 |
| InChI | InChI=1S/C23H28N4O2/c28-22(20-18-8-4-5-9-19(18)25-29-20)24-21-16-12-26-10-11-27(13-16)15-23(21,14-26)17-6-2-1-3-7-17/h1-3,6-7,16,21H,4-5,8-15H2,(H,24,28) |
| InChIKey | KETUPTXRFMSKPP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |