C24H19NO4 — CID 13193830
methyl 2-[[(Z)-1,4-dioxo-1,4-diphenylbut-2-en-2-yl]amino]benzoate (PubChem CID 13193830) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl 2-[[(Z)-1,4-dioxo-1,4-diphenylbut-2-en-2-yl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-1,4-dioxo-1,4-diphenylbut-2-en-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 13193830 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 2-[[(Z)-1,4-dioxo-1,4-diphenylbut-2-en-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N/C(=C\C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19NO4/c1-29-24(28)19-14-8-9-15-20(19)25-21(23(27)18-12-6-3-7-13-18)16-22(26)17-10-4-2-5-11-17/h2-16,25H,1H3/b21-16- |
| InChIKey | ZQKPHZKMELAEGD-PGMHBOJBSA-N |
| XLogP | 4.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|