C16H30N2O2 — CID 131943805
2-cyclopentyl-1-[3-[(dimethylamino)methyl]-3-(hydroxymethyl)piperidin-1-yl]ethanone (PubChem CID 131943805) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-cyclopentyl-1-[3-[(dimethylamino)methyl]-3-(hydroxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[3-[(dimethylamino)methyl]-3-(hydroxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 131943805 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-cyclopentyl-1-[3-[(dimethylamino)methyl]-3-(hydroxymethyl)piperidin-1-yl]ethanone |
| SMILES | CN(C)CC1(CO)CCCN(C(=O)CC2CCCC2)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-17(2)11-16(13-19)8-5-9-18(12-16)15(20)10-14-6-3-4-7-14/h14,19H,3-13H2,1-2H3 |
| InChIKey | DUGYVEPFZIBCMJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |