C22H32N2O2 — CID 131944371
N-cyclopentyl-N-[(2-methylphenyl)methyl]-3-(2-oxoazepan-1-yl)propanamide (PubChem CID 131944371) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-cyclopentyl-N-[(2-methylphenyl)methyl]-3-(2-oxoazepan-1-yl)propanamide.
| Compound Name | N-cyclopentyl-N-[(2-methylphenyl)methyl]-3-(2-oxoazepan-1-yl)propanamide |
|---|---|
| PubChem CID | 131944371 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | N-cyclopentyl-N-[(2-methylphenyl)methyl]-3-(2-oxoazepan-1-yl)propanamide |
| SMILES | Cc1ccccc1CN(C(=O)CCN1CCCCCC1=O)C1CCCC1 |
| InChI | InChI=1S/C22H32N2O2/c1-18-9-4-5-10-19(18)17-24(20-11-6-7-12-20)22(26)14-16-23-15-8-2-3-13-21(23)25/h4-5,9-10,20H,2-3,6-8,11-17H2,1H3 |
| InChIKey | DFJBORWUDAFPFG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |