C21H30N2O2 — CID 131944828
3-ethyl-5-hydroxy-N-(3-pyridin-2-ylpropyl)adamantane-1-carboxamide (PubChem CID 131944828) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 3-ethyl-5-hydroxy-N-(3-pyridin-2-ylpropyl)adamantane-1-carboxamide.
| Compound Name | 3-ethyl-5-hydroxy-N-(3-pyridin-2-ylpropyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 131944828 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 3-ethyl-5-hydroxy-N-(3-pyridin-2-ylpropyl)adamantane-1-carboxamide |
| SMILES | CCC12CC3CC(O)(C1)CC(C(=O)NCCCc1ccccn1)(C3)C2 |
| InChI | InChI=1S/C21H30N2O2/c1-2-19-10-16-11-20(13-19,15-21(25,12-16)14-19)18(24)23-9-5-7-17-6-3-4-8-22-17/h3-4,6,8,16,25H,2,5,7,9-15H2,1H3,(H,23,24) |
| InChIKey | JDMUJHAYPZNJLV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|