C15H18ClN3S — CID 131944851
5-[[3-(4-chlorophenyl)piperidin-1-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 131944851) has the molecular formula C15H18ClN3S and a molecular weight of 307.85 g/mol. Its IUPAC name is 5-[[3-(4-chlorophenyl)piperidin-1-yl]methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[[3-(4-chlorophenyl)piperidin-1-yl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131944851 |
| Molecular Formula | C15H18ClN3S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 5-[[3-(4-chlorophenyl)piperidin-1-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCCC(c3ccc(Cl)cc3)C2)s1 |
| InChI | InChI=1S/C15H18ClN3S/c16-13-5-3-11(4-6-13)12-2-1-7-19(9-12)10-14-8-18-15(17)20-14/h3-6,8,12H,1-2,7,9-10H2,(H2,17,18) |
| InChIKey | PPDCALCXYZAEPF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |