C15H20N4S — CID 120901186
5-[(3-anilinopiperidin-1-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 120901186) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 5-[(3-anilinopiperidin-1-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(3-anilinopiperidin-1-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120901186 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5-[(3-anilinopiperidin-1-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(CN2CCCC(Nc3ccccc3)C2)s1 |
| InChI | InChI=1S/C15H20N4S/c16-15-17-9-14(20-15)11-19-8-4-7-13(10-19)18-12-5-2-1-3-6-12/h1-3,5-6,9,13,18H,4,7-8,10-11H2,(H2,16,17) |
| InChIKey | OYWQQIJBJVJIBG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |