C13H22N4OS — CID 120899494
N-[1-[(2-amino-1,3-thiazol-5-yl)methyl]piperidin-3-yl]butanamide (PubChem CID 120899494) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is N-[1-[(2-amino-1,3-thiazol-5-yl)methyl]piperidin-3-yl]butanamide.
| Compound Name | N-[1-[(2-amino-1,3-thiazol-5-yl)methyl]piperidin-3-yl]butanamide |
|---|---|
| PubChem CID | 120899494 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[1-[(2-amino-1,3-thiazol-5-yl)methyl]piperidin-3-yl]butanamide |
| SMILES | CCCC(=O)NC1CCCN(Cc2cnc(N)s2)C1 |
| InChI | InChI=1S/C13H22N4OS/c1-2-4-12(18)16-10-5-3-6-17(8-10)9-11-7-15-13(14)19-11/h7,10H,2-6,8-9H2,1H3,(H2,14,15)(H,16,18) |
| InChIKey | PBOIMEPMZNAYPR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |