About ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate
ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate (PubChem CID 84593468) has the molecular formula C17H22N4O2S
and a molecular weight of 346.46 g/mol. Its IUPAC name is ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate |
| PubChem CID | 84593468 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(Cc2cnc(-c3cccnc3)s2)C1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-23-17(22)20-14-6-4-8-21(11-14)12-15-10-19-16(24-15)13-5-3-7-18-9-13/h3,5,7,9-10,14H,2,4,6,8,11-12H2,1H3,(H,20,22) |
| InChIKey | HSFNFFMEVPEHIF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate?
The IUPAC name of ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate (CID 84593468) is ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate.
What is the SMILES notation for ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate?
The canonical SMILES for ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate is CCOC(=O)NC1CCCN(Cc2cnc(-c3cccnc3)s2)C1.
What is the InChIKey of ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate?
The InChIKey is HSFNFFMEVPEHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2S/c1-2-23-17(22)20-14-6-4-8-21(11-14)12-15-10-19-16(24-15)13-5-3-7-18-9-13/h3,5,7,9-10,14H,2,4,6,8,11-12H2,1H3,(H,20,22).
What are the key properties of ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate?
ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate has a molecular weight of 346.46 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[1-[(2-pyridin-3-yl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]carbamate is sourced from PubChem (CID 84593468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).