C17H24N4O2S — CID 120901310
5-[[3-(3,5-dimethoxyanilino)piperidin-1-yl]methyl]-1,3-thiazol-2-amine (PubChem CID 120901310) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 5-[[3-(3,5-dimethoxyanilino)piperidin-1-yl]methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[[3-(3,5-dimethoxyanilino)piperidin-1-yl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 120901310 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-[[3-(3,5-dimethoxyanilino)piperidin-1-yl]methyl]-1,3-thiazol-2-amine |
| SMILES | COc1cc(NC2CCCN(Cc3cnc(N)s3)C2)cc(OC)c1 |
| InChI | InChI=1S/C17H24N4O2S/c1-22-14-6-13(7-15(8-14)23-2)20-12-4-3-5-21(10-12)11-16-9-19-17(18)24-16/h6-9,12,20H,3-5,10-11H2,1-2H3,(H2,18,19) |
| InChIKey | OOULZOVHIGAKNE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |