C17H29FN4O — CID 131945640
N-[[1-(5-fluoropentyl)piperidin-3-yl]methyl]-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 131945640) has the molecular formula C17H29FN4O and a molecular weight of 324.44 g/mol. Its IUPAC name is N-[[1-(5-fluoropentyl)piperidin-3-yl]methyl]-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[[1-(5-fluoropentyl)piperidin-3-yl]methyl]-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 131945640 |
| Molecular Formula | C17H29FN4O |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | N-[[1-(5-fluoropentyl)piperidin-3-yl]methyl]-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)NCC1CCCN(CCCCCF)C1 |
| InChI | InChI=1S/C17H29FN4O/c1-14-16(13-21(2)20-14)17(23)19-11-15-7-6-10-22(12-15)9-5-3-4-8-18/h13,15H,3-12H2,1-2H3,(H,19,23) |
| InChIKey | UIEPPQGBRSFLTE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|