C19H27N3O — CID 131946732
N-(1-ethyl-2-methylindol-5-yl)-1-methylazepane-2-carboxamide (PubChem CID 131946732) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is N-(1-ethyl-2-methylindol-5-yl)-1-methylazepane-2-carboxamide.
| Compound Name | N-(1-ethyl-2-methylindol-5-yl)-1-methylazepane-2-carboxamide |
|---|---|
| PubChem CID | 131946732 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-(1-ethyl-2-methylindol-5-yl)-1-methylazepane-2-carboxamide |
| SMILES | CCn1c(C)cc2cc(NC(=O)C3CCCCCN3C)ccc21 |
| InChI | InChI=1S/C19H27N3O/c1-4-22-14(2)12-15-13-16(9-10-17(15)22)20-19(23)18-8-6-5-7-11-21(18)3/h9-10,12-13,18H,4-8,11H2,1-3H3,(H,20,23) |
| InChIKey | IQRSHOZLORRFDM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |