C17H21F2N3O — CID 72862845
N-(1-ethyl-2-methylindol-5-yl)-4,4-difluoropiperidine-1-carboxamide (PubChem CID 72862845) has the molecular formula C17H21F2N3O and a molecular weight of 321.37 g/mol. Its IUPAC name is N-(1-ethyl-2-methylindol-5-yl)-4,4-difluoropiperidine-1-carboxamide.
| Compound Name | N-(1-ethyl-2-methylindol-5-yl)-4,4-difluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 72862845 |
| Molecular Formula | C17H21F2N3O |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-(1-ethyl-2-methylindol-5-yl)-4,4-difluoropiperidine-1-carboxamide |
| SMILES | CCn1c(C)cc2cc(NC(=O)N3CCC(F)(F)CC3)ccc21 |
| InChI | InChI=1S/C17H21F2N3O/c1-3-22-12(2)10-13-11-14(4-5-15(13)22)20-16(23)21-8-6-17(18,19)7-9-21/h4-5,10-11H,3,6-9H2,1-2H3,(H,20,23) |
| InChIKey | YNSUNKJYWASOMQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |