C16H21F2N3O2 — CID 118768211
N-[3-(butanoylamino)phenyl]-4,4-difluoropiperidine-1-carboxamide (PubChem CID 118768211) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is N-[3-(butanoylamino)phenyl]-4,4-difluoropiperidine-1-carboxamide.
| Compound Name | N-[3-(butanoylamino)phenyl]-4,4-difluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 118768211 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-[3-(butanoylamino)phenyl]-4,4-difluoropiperidine-1-carboxamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)N2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C16H21F2N3O2/c1-2-4-14(22)19-12-5-3-6-13(11-12)20-15(23)21-9-7-16(17,18)8-10-21/h3,5-6,11H,2,4,7-10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | XWTSEIJWDOTKBU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |