C12H12BrF3N2O — CID 171854817
N-(4-bromo-3-fluorophenyl)-4,4-difluoropiperidine-1-carboxamide (PubChem CID 171854817) has the molecular formula C12H12BrF3N2O and a molecular weight of 337.14 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-4,4-difluoropiperidine-1-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-4,4-difluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 171854817 |
| Molecular Formula | C12H12BrF3N2O |
| Molecular Weight | 337.14 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-4,4-difluoropiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(F)c1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H12BrF3N2O/c13-9-2-1-8(7-10(9)14)17-11(19)18-5-3-12(15,16)4-6-18/h1-2,7H,3-6H2,(H,17,19) |
| InChIKey | CYBDDQFCEUXFJS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.14 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |