C13H13BrF4N2O — CID 171854816
N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 171854816) has the molecular formula C13H13BrF4N2O and a molecular weight of 369.16 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 171854816 |
| Molecular Formula | C13H13BrF4N2O |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(F)c1)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H13BrF4N2O/c14-10-2-1-9(7-11(10)15)19-12(21)20-5-3-8(4-6-20)13(16,17)18/h1-2,7-8H,3-6H2,(H,19,21) |
| InChIKey | KLHYCPBVZPVROZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |