C19H24ClN3O3 — CID 131947393
N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 131947393) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 131947393 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[4-chloro-3-(ethylcarbamoyl)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCNC(=O)c1cc(NC(=O)C2CC(=O)N(C3CCCC3)C2)ccc1Cl |
| InChI | InChI=1S/C19H24ClN3O3/c1-2-21-19(26)15-10-13(7-8-16(15)20)22-18(25)12-9-17(24)23(11-12)14-5-3-4-6-14/h7-8,10,12,14H,2-6,9,11H2,1H3,(H,21,26)(H,22,25) |
| InChIKey | SUDOZSJTORCXBC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |