C17H24N4O3S — CID 131948153
N-[(2-imidazol-1-ylphenyl)methyl]-3-(methoxymethyl)piperidine-1-sulfonamide (PubChem CID 131948153) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[(2-imidazol-1-ylphenyl)methyl]-3-(methoxymethyl)piperidine-1-sulfonamide.
| Compound Name | N-[(2-imidazol-1-ylphenyl)methyl]-3-(methoxymethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 131948153 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[(2-imidazol-1-ylphenyl)methyl]-3-(methoxymethyl)piperidine-1-sulfonamide |
| SMILES | COCC1CCCN(S(=O)(=O)NCc2ccccc2-n2ccnc2)C1 |
| InChI | InChI=1S/C17H24N4O3S/c1-24-13-15-5-4-9-21(12-15)25(22,23)19-11-16-6-2-3-7-17(16)20-10-8-18-14-20/h2-3,6-8,10,14-15,19H,4-5,9,11-13H2,1H3 |
| InChIKey | KRMPJMSWLPMHKY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |