C18H25N5O3S — CID 46772253
1-(dimethylsulfamoyl)-N-[(2-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 46772253) has the molecular formula C18H25N5O3S and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-N-[(2-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(dimethylsulfamoyl)-N-[(2-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46772253 |
| Molecular Formula | C18H25N5O3S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-(dimethylsulfamoyl)-N-[(2-imidazol-1-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC(C(=O)NCc2ccccc2-n2ccnc2)C1 |
| InChI | InChI=1S/C18H25N5O3S/c1-21(2)27(25,26)23-10-5-7-16(13-23)18(24)20-12-15-6-3-4-8-17(15)22-11-9-19-14-22/h3-4,6,8-9,11,14,16H,5,7,10,12-13H2,1-2H3,(H,20,24) |
| InChIKey | YWYRGXPHRYHRHB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |