C16H25N3O4S — CID 93486945
(3S)-1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 93486945) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is (3S)-1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93486945 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (3S)-1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)[C@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C16H25N3O4S/c1-18(2)24(21,22)19-10-6-8-14(12-19)16(20)17-11-13-7-4-5-9-15(13)23-3/h4-5,7,9,14H,6,8,10-12H2,1-3H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | GGKMCGFFYFEKPQ-AWEZNQCLSA-N |
| XLogP | 0.83 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |