C17H27N3O4S — CID 132762136
1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]-N-methylpiperidine-3-carboxamide (PubChem CID 132762136) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 132762136 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-(dimethylsulfamoyl)-N-[(2-methoxyphenyl)methyl]-N-methylpiperidine-3-carboxamide |
| SMILES | COc1ccccc1CN(C)C(=O)C1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C17H27N3O4S/c1-18(2)25(22,23)20-11-7-9-15(13-20)17(21)19(3)12-14-8-5-6-10-16(14)24-4/h5-6,8,10,15H,7,9,11-13H2,1-4H3 |
| InChIKey | OHDVOHFNHUHPKS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |