C16H24N4O2 — CID 131951323
1-[4-methoxy-3-(methoxymethyl)phenyl]-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine (PubChem CID 131951323) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[4-methoxy-3-(methoxymethyl)phenyl]-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine.
| Compound Name | 1-[4-methoxy-3-(methoxymethyl)phenyl]-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 131951323 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-[4-methoxy-3-(methoxymethyl)phenyl]-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]methanamine |
| SMILES | CCCn1cnnc1CNCc1ccc(OC)c(COC)c1 |
| InChI | InChI=1S/C16H24N4O2/c1-4-7-20-12-18-19-16(20)10-17-9-13-5-6-15(22-3)14(8-13)11-21-2/h5-6,8,12,17H,4,7,9-11H2,1-3H3 |
| InChIKey | FFLYEGGWJIJSNE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|