C10H18N4O2S — CID 131951524
1-(2-methylsulfonylethyl)-3-(1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 131951524) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-(2-methylsulfonylethyl)-3-(1H-1,2,4-triazol-5-yl)piperidine.
| Compound Name | 1-(2-methylsulfonylethyl)-3-(1H-1,2,4-triazol-5-yl)piperidine |
|---|---|
| PubChem CID | 131951524 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(2-methylsulfonylethyl)-3-(1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | CS(=O)(=O)CCN1CCCC(c2ncn[nH]2)C1 |
| InChI | InChI=1S/C10H18N4O2S/c1-17(15,16)6-5-14-4-2-3-9(7-14)10-11-8-12-13-10/h8-9H,2-7H2,1H3,(H,11,12,13) |
| InChIKey | RLQZRLCFPSOQRD-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |