About 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide
3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 131951985) has the molecular formula C14H20ClFN2O2S
and a molecular weight of 334.84 g/mol. Its IUPAC name is 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide |
| PubChem CID | 131951985 |
| Molecular Formula | C14H20ClFN2O2S |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN1CCC(C)(CN(C)S(=O)(=O)c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H20ClFN2O2S/c1-14(6-7-17(2)9-14)10-18(3)21(19,20)11-4-5-13(16)12(15)8-11/h4-5,8H,6-7,9-10H2,1-3H3 |
| InChIKey | FBYYSASUEQZFRO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide?
The IUPAC name of 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide (CID 131951985) is 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide.
What is the SMILES notation for 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide?
The canonical SMILES for 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide is CN1CCC(C)(CN(C)S(=O)(=O)c2ccc(F)c(Cl)c2)C1.
What is the InChIKey of 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide?
The InChIKey is FBYYSASUEQZFRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClFN2O2S/c1-14(6-7-17(2)9-14)10-18(3)21(19,20)11-4-5-13(16)12(15)8-11/h4-5,8H,6-7,9-10H2,1-3H3.
What are the key properties of 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide?
3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide has a molecular weight of 334.84 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]-4-fluoro-N-methylbenzenesulfonamide is sourced from PubChem (CID 131951985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).