C12H12N4 — CID 13195247
2-quinolin-8-yl-3,4-dihydropyrazol-5-amine (PubChem CID 13195247) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 2-quinolin-8-yl-3,4-dihydropyrazol-5-amine.
| Compound Name | 2-quinolin-8-yl-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 13195247 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-quinolin-8-yl-3,4-dihydropyrazol-5-amine |
| SMILES | NC1=NN(c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C12H12N4/c13-11-6-8-16(15-11)10-5-1-3-9-4-2-7-14-12(9)10/h1-5,7H,6,8H2,(H2,13,15) |
| InChIKey | QKZNSARAACLNAQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |