C21H28Cl2N6O3 — CID 131953925
(4,6-dichloro-2-pyridinyl)methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 131953925) has the molecular formula C21H28Cl2N6O3 and a molecular weight of 483.40 g/mol. Its IUPAC name is (4,6-dichloro-2-pyridinyl)methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | (4,6-dichloro-2-pyridinyl)methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 131953925 |
| Molecular Formula | C21H28Cl2N6O3 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (4,6-dichloro-2-pyridinyl)methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazole-5-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc(Cl)n1)N1CCC2(CC1)CN(C(=O)C1CCC3NNNC3C1)C2 |
| InChI | InChI=1S/C21H28Cl2N6O3/c22-14-8-15(24-18(23)9-14)10-32-20(31)28-5-3-21(4-6-28)11-29(12-21)19(30)13-1-2-16-17(7-13)26-27-25-16/h8-9,13,16-17,25-27H,1-7,10-12H2 |
| InChIKey | QECOFKJXWLHBML-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|