C24H29F3N4O3 — CID 152820237
[4-(trifluoromethyl)phenyl]methyl 2-(3a,4,5,6,7,7a-hexahydro-3H-indazole-6-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 152820237) has the molecular formula C24H29F3N4O3 and a molecular weight of 478.52 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 2-(3a,4,5,6,7,7a-hexahydro-3H-indazole-6-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 2-(3a,4,5,6,7,7a-hexahydro-3H-indazole-6-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 152820237 |
| Molecular Formula | C24H29F3N4O3 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 2-(3a,4,5,6,7,7a-hexahydro-3H-indazole-6-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | O=C(OCc1ccc(C(F)(F)F)cc1)N1CCC2(CC1)CN(C(=O)C1CCC3CN=NC3C1)C2 |
| InChI | InChI=1S/C24H29F3N4O3/c25-24(26,27)19-5-1-16(2-6-19)13-34-22(33)30-9-7-23(8-10-30)14-31(15-23)21(32)17-3-4-18-12-28-29-20(18)11-17/h1-2,5-6,17-18,20H,3-4,7-15H2 |
| InChIKey | STJORZWGGGMJFL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |