C23H20FN3O4S — CID 1319625
(6S)-2-[(2-fluorobenzoyl)amino]-6-methyl-N-(3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 1319625) has the molecular formula C23H20FN3O4S and a molecular weight of 453.50 g/mol. Its IUPAC name is (6S)-2-[(2-fluorobenzoyl)amino]-6-methyl-N-(3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-2-[(2-fluorobenzoyl)amino]-6-methyl-N-(3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 1319625 |
| Molecular Formula | C23H20FN3O4S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (6S)-2-[(2-fluorobenzoyl)amino]-6-methyl-N-(3-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C[C@H]1CCc2c(sc(NC(=O)c3ccccc3F)c2C(=O)Nc2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H20FN3O4S/c1-13-9-10-17-19(11-13)32-23(26-21(28)16-7-2-3-8-18(16)24)20(17)22(29)25-14-5-4-6-15(12-14)27(30)31/h2-8,12-13H,9-11H2,1H3,(H,25,29)(H,26,28)/t13-/m0/s1 |
| InChIKey | CYSUBPLGSZYQTJ-ZDUSSCGKSA-N |
| XLogP | 5.42 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|