C26H24N4O8S — CID 18883905
2-[[6-methyl-2-[(2-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-nitrobenzoate (PubChem CID 18883905) has the molecular formula C26H24N4O8S and a molecular weight of 552.57 g/mol. Its IUPAC name is 2-[[6-methyl-2-[(2-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-nitrobenzoate.
| Compound Name | 2-[[6-methyl-2-[(2-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-nitrobenzoate |
|---|---|
| PubChem CID | 18883905 |
| Molecular Formula | C26H24N4O8S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 2-[[6-methyl-2-[(2-nitrobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]ethyl 2-nitrobenzoate |
| SMILES | CC1CCc2c(sc(NC(=O)c3ccccc3[N+](=O)[O-])c2C(=O)NCCOC(=O)c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C26H24N4O8S/c1-15-10-11-18-21(14-15)39-25(28-23(31)16-6-2-4-8-19(16)29(34)35)22(18)24(32)27-12-13-38-26(33)17-7-3-5-9-20(17)30(36)37/h2-9,15H,10-14H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | ZXMBQLNFFWKVQM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|