C17H26N2O2S — CID 131962697
2,2-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]-3H-indole (PubChem CID 131962697) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]-3H-indole.
| Compound Name | 2,2-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]-3H-indole |
|---|---|
| PubChem CID | 131962697 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2,2-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]-3H-indole |
| SMILES | CC1(C)Cc2ccccc2N1CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C17H26N2O2S/c1-17(2)11-15-8-4-5-9-16(15)19(17)13-14-7-6-10-18(12-14)22(3,20)21/h4-5,8-9,14H,6-7,10-13H2,1-3H3 |
| InChIKey | FDNBOJOPRPTEEW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |