C13H23N3O4S — CID 79619740
3,3-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]piperazine-2,6-dione (PubChem CID 79619740) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 79619740 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3,3-dimethyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]piperazine-2,6-dione |
| SMILES | CC1(C)NCC(=O)N(CC2CCCN(S(C)(=O)=O)C2)C1=O |
| InChI | InChI=1S/C13H23N3O4S/c1-13(2)12(18)16(11(17)7-14-13)9-10-5-4-6-15(8-10)21(3,19)20/h10,14H,4-9H2,1-3H3 |
| InChIKey | PTMOXIHWAMTEIA-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|