C16H25N5 — CID 131963123
N-[4-(4-methylpiperazin-1-yl)butan-2-yl]-1H-benzimidazol-2-amine (PubChem CID 131963123) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)butan-2-yl]-1H-benzimidazol-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)butan-2-yl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 131963123 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)butan-2-yl]-1H-benzimidazol-2-amine |
| SMILES | CC(CCN1CCN(C)CC1)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H25N5/c1-13(7-8-21-11-9-20(2)10-12-21)17-16-18-14-5-3-4-6-15(14)19-16/h3-6,13H,7-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | JVEDCUQYTLIOJN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |