C23H28N6OS — CID 155619183
(Z)-3-amino-N-(1H-benzimidazol-2-yl)-4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylbut-2-enamide (PubChem CID 155619183) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is (Z)-3-amino-N-(1H-benzimidazol-2-yl)-4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylbut-2-enamide.
| Compound Name | (Z)-3-amino-N-(1H-benzimidazol-2-yl)-4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylbut-2-enamide |
|---|---|
| PubChem CID | 155619183 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (Z)-3-amino-N-(1H-benzimidazol-2-yl)-4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]sulfanylbut-2-enamide |
| SMILES | CN1CCN(Cc2ccc(SC/C(N)=C/C(=O)Nc3nc4ccccc4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C23H28N6OS/c1-28-10-12-29(13-11-28)15-17-6-8-19(9-7-17)31-16-18(24)14-22(30)27-23-25-20-4-2-3-5-21(20)26-23/h2-9,14H,10-13,15-16,24H2,1H3,(H2,25,26,27,30)/b18-14- |
| InChIKey | KTJBLMOSFTZGJN-JXAWBTAJSA-N |
| XLogP | 2.88 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|