C20H26N2O3 — CID 131963954
1-[(2R)-1-hydroxypropan-2-yl]-1-methyl-3-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]urea (PubChem CID 131963954) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxypropan-2-yl]-1-methyl-3-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]urea.
| Compound Name | 1-[(2R)-1-hydroxypropan-2-yl]-1-methyl-3-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]urea |
|---|---|
| PubChem CID | 131963954 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(2R)-1-hydroxypropan-2-yl]-1-methyl-3-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]urea |
| SMILES | Cc1cccc(COc2ccc(NC(=O)N(C)[C@H](C)CO)c(C)c2)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-14-6-5-7-17(10-14)13-25-18-8-9-19(15(2)11-18)21-20(24)22(4)16(3)12-23/h5-11,16,23H,12-13H2,1-4H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | BUAZHBRABJQYMJ-MRXNPFEDSA-N |
| XLogP | 3.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |