C20H26N2O2 — CID 119318002
2-amino-N-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]pentanamide (PubChem CID 119318002) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-amino-N-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]pentanamide.
| Compound Name | 2-amino-N-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]pentanamide |
|---|---|
| PubChem CID | 119318002 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-amino-N-[2-methyl-4-[(3-methylphenyl)methoxy]phenyl]pentanamide |
| SMILES | CCCC(N)C(=O)Nc1ccc(OCc2cccc(C)c2)cc1C |
| InChI | InChI=1S/C20H26N2O2/c1-4-6-18(21)20(23)22-19-10-9-17(12-15(19)3)24-13-16-8-5-7-14(2)11-16/h5,7-12,18H,4,6,13,21H2,1-3H3,(H,22,23) |
| InChIKey | FAQXQCMCVCSSCL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |