C11H8N2O — CID 131964300
(1Z,7Z)-2,5-benzodiazonin-6-one (PubChem CID 131964300) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is (1Z,7Z)-2,5-benzodiazonin-6-one.
| Compound Name | (1Z,7Z)-2,5-benzodiazonin-6-one |
|---|---|
| PubChem CID | 131964300 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (1Z,7Z)-2,5-benzodiazonin-6-one |
| SMILES | O=C1/C=c2/cccc/c2=C/N=C\C=N/1 |
| InChI | InChI=1S/C11H8N2O/c14-11-7-9-3-1-2-4-10(9)8-12-5-6-13-11/h1-8H/b9-7-,10-8-,12-5-,13-6- |
| InChIKey | PBPBVEAFHHWLBB-ALTKOIDNSA-N |
| XLogP | -0.11 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |