About (1Z,7Z)-2,5-benzodiazonin-6-one
(1Z,7Z)-2,5-benzodiazonin-6-one (PubChem CID 131964300) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is (1Z,7Z)-2,5-benzodiazonin-6-one.
Molecular Properties
| Compound Name | (1Z,7Z)-2,5-benzodiazonin-6-one |
| PubChem CID | 131964300 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (1Z,7Z)-2,5-benzodiazonin-6-one |
| SMILES | O=C1/C=c2/cccc/c2=C/N=C\C=N/1 |
| InChI | InChI=1S/C11H8N2O/c14-11-7-9-3-1-2-4-10(9)8-12-5-6-13-11/h1-8H/b9-7-,10-8-,12-5-,13-6- |
| InChIKey | PBPBVEAFHHWLBB-ALTKOIDNSA-N |
| XLogP | -0.11 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1Z,7Z)-2,5-benzodiazonin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,7Z)-2,5-benzodiazonin-6-one?
The IUPAC name of (1Z,7Z)-2,5-benzodiazonin-6-one (CID 131964300) is (1Z,7Z)-2,5-benzodiazonin-6-one.
What is the SMILES notation for (1Z,7Z)-2,5-benzodiazonin-6-one?
The canonical SMILES for (1Z,7Z)-2,5-benzodiazonin-6-one is O=C1/C=c2/cccc/c2=C/N=C\C=N/1.
What is the InChIKey of (1Z,7Z)-2,5-benzodiazonin-6-one?
The InChIKey is PBPBVEAFHHWLBB-ALTKOIDNSA-N. The full InChI is InChI=1S/C11H8N2O/c14-11-7-9-3-1-2-4-10(9)8-12-5-6-13-11/h1-8H/b9-7-,10-8-,12-5-,13-6-.
What are the key properties of (1Z,7Z)-2,5-benzodiazonin-6-one?
(1Z,7Z)-2,5-benzodiazonin-6-one has a molecular weight of 184.20 g/mol, XLogP of -0.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,7Z)-2,5-benzodiazonin-6-one is sourced from PubChem (CID 131964300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).