C23H25N5O2S — CID 131968174
4-[4-[[2-[[(1R)-2-methylidenecyclohexyl]amino]-1,3-benzothiazol-6-yl]oxy]-2-pyridinyl]piperazin-2-one (PubChem CID 131968174) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 4-[4-[[2-[[(1R)-2-methylidenecyclohexyl]amino]-1,3-benzothiazol-6-yl]oxy]-2-pyridinyl]piperazin-2-one.
| Compound Name | 4-[4-[[2-[[(1R)-2-methylidenecyclohexyl]amino]-1,3-benzothiazol-6-yl]oxy]-2-pyridinyl]piperazin-2-one |
|---|---|
| PubChem CID | 131968174 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-[4-[[2-[[(1R)-2-methylidenecyclohexyl]amino]-1,3-benzothiazol-6-yl]oxy]-2-pyridinyl]piperazin-2-one |
| SMILES | C=C1CCCC[C@H]1Nc1nc2ccc(Oc3ccnc(N4CCNC(=O)C4)c3)cc2s1 |
| InChI | InChI=1S/C23H25N5O2S/c1-15-4-2-3-5-18(15)26-23-27-19-7-6-16(12-20(19)31-23)30-17-8-9-24-21(13-17)28-11-10-25-22(29)14-28/h6-9,12-13,18H,1-5,10-11,14H2,(H,25,29)(H,26,27)/t18-/m1/s1 |
| InChIKey | LVFMXRRYJUBCOX-GOSISDBHSA-N |
| XLogP | 4.33 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|