C23H28N2 — CID 131968958
8-(4-but-3-enyl-1-methylcyclohexa-2,4-dien-1-yl)-4-ethenyl-5a,6-dihydro-3H-1-benzazepin-2-amine (PubChem CID 131968958) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 8-(4-but-3-enyl-1-methylcyclohexa-2,4-dien-1-yl)-4-ethenyl-5a,6-dihydro-3H-1-benzazepin-2-amine.
| Compound Name | 8-(4-but-3-enyl-1-methylcyclohexa-2,4-dien-1-yl)-4-ethenyl-5a,6-dihydro-3H-1-benzazepin-2-amine |
|---|---|
| PubChem CID | 131968958 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 8-(4-but-3-enyl-1-methylcyclohexa-2,4-dien-1-yl)-4-ethenyl-5a,6-dihydro-3H-1-benzazepin-2-amine |
| SMILES | C=CCCC1=CCC(C)(C2=CCC3C=C(C=C)CC(N)=NC3=C2)C=C1 |
| InChI | InChI=1S/C23H28N2/c1-4-6-7-18-10-12-23(3,13-11-18)20-9-8-19-14-17(5-2)15-22(24)25-21(19)16-20/h4-5,9-12,14,16,19H,1-2,6-8,13,15H2,3H3,(H2,24,25) |
| InChIKey | QUJKJJRZUXWVON-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|