C24H25Cl2F2N5O3 — CID 131969610
N-[5-chloro-4-(1,1-difluoropropyl)-5-methylcyclohexa-1,3-dien-1-yl]-4-[3-chloro-5-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 131969610) has the molecular formula C24H25Cl2F2N5O3 and a molecular weight of 540.40 g/mol. Its IUPAC name is N-[5-chloro-4-(1,1-difluoropropyl)-5-methylcyclohexa-1,3-dien-1-yl]-4-[3-chloro-5-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[5-chloro-4-(1,1-difluoropropyl)-5-methylcyclohexa-1,3-dien-1-yl]-4-[3-chloro-5-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 131969610 |
| Molecular Formula | C24H25Cl2F2N5O3 |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N-[5-chloro-4-(1,1-difluoropropyl)-5-methylcyclohexa-1,3-dien-1-yl]-4-[3-chloro-5-[5-(hydroxymethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CCC(F)(F)C1=CC=C(NC(=O)N2CC=C(c3ncc(-c4noc(CO)n4)cc3Cl)CC2)CC1(C)Cl |
| InChI | InChI=1S/C24H25Cl2F2N5O3/c1-3-24(27,28)18-5-4-16(11-23(18,2)26)30-22(35)33-8-6-14(7-9-33)20-17(25)10-15(12-29-20)21-31-19(13-34)36-32-21/h4-6,10,12,34H,3,7-9,11,13H2,1-2H3,(H,30,35) |
| InChIKey | HMZMRRNTGRSTAF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|