About 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine
2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine (PubChem CID 131970569) has the molecular formula C5H6BrFN4
and a molecular weight of 221.03 g/mol. Its IUPAC name is 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine |
| PubChem CID | 131970569 |
| Molecular Formula | C5H6BrFN4 |
| Molecular Weight | 221.03 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine |
| SMILES | NN=NC1NC=C(Br)C=C1F |
| InChI | InChI=1S/C5H6BrFN4/c6-3-1-4(7)5(9-2-3)10-11-8/h1-2,5,9H,(H2,8,10) |
| InChIKey | DMARNPWUZWTLKK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.03 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine?
The IUPAC name of 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine (CID 131970569) is 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine.
What is the SMILES notation for 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine?
The canonical SMILES for 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine is NN=NC1NC=C(Br)C=C1F.
What is the InChIKey of 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine?
The InChIKey is DMARNPWUZWTLKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrFN4/c6-3-1-4(7)5(9-2-3)10-11-8/h1-2,5,9H,(H2,8,10).
What are the key properties of 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine?
2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine has a molecular weight of 221.03 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminodiazenyl)-5-bromo-3-fluoro-1,2-dihydropyridine is sourced from PubChem (CID 131970569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).