C5H7BrFN3 — CID 170340688
5-bromo-3-fluoro-2H-pyridine-1,2-diamine (PubChem CID 170340688) has the molecular formula C5H7BrFN3 and a molecular weight of 208.03 g/mol. Its IUPAC name is 5-bromo-3-fluoro-2H-pyridine-1,2-diamine.
| Compound Name | 5-bromo-3-fluoro-2H-pyridine-1,2-diamine |
|---|---|
| PubChem CID | 170340688 |
| Molecular Formula | C5H7BrFN3 |
| Molecular Weight | 208.03 g/mol |
| Exact Mass | 206.98 |
| IUPAC Name | 5-bromo-3-fluoro-2H-pyridine-1,2-diamine |
| SMILES | NC1C(F)=CC(Br)=CN1N |
| InChI | InChI=1S/C5H7BrFN3/c6-3-1-4(7)5(8)10(9)2-3/h1-2,5H,8-9H2 |
| InChIKey | URMBVOMPBFMSRK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.03 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|