C6H6Br2FN — CID 163748070
2,6-dibromo-4-fluorocyclohexa-2,4-dien-1-amine (PubChem CID 163748070) has the molecular formula C6H6Br2FN and a molecular weight of 270.93 g/mol. Its IUPAC name is 2,6-dibromo-4-fluorocyclohexa-2,4-dien-1-amine.
| Compound Name | 2,6-dibromo-4-fluorocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 163748070 |
| Molecular Formula | C6H6Br2FN |
| Molecular Weight | 270.93 g/mol |
| Exact Mass | 268.89 |
| IUPAC Name | 2,6-dibromo-4-fluorocyclohexa-2,4-dien-1-amine |
| SMILES | NC1C(Br)=CC(F)=CC1Br |
| InChI | InChI=1S/C6H6Br2FN/c7-4-1-3(9)2-5(8)6(4)10/h1-2,4,6H,10H2 |
| InChIKey | LNPSXHMJBNAFMI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.93 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|