C6H9BrO4 — CID 15318263
(1R,2S,3R,4S)-5-bromocyclohex-5-ene-1,2,3,4-tetrol (PubChem CID 15318263) has the molecular formula C6H9BrO4 and a molecular weight of 225.04 g/mol. Its IUPAC name is (1R,2S,3R,4S)-5-bromocyclohex-5-ene-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3R,4S)-5-bromocyclohex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 15318263 |
| Molecular Formula | C6H9BrO4 |
| Molecular Weight | 225.04 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | (1R,2S,3R,4S)-5-bromocyclohex-5-ene-1,2,3,4-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)C(Br)=C[C@H]1O |
| InChI | InChI=1S/C6H9BrO4/c7-2-1-3(8)5(10)6(11)4(2)9/h1,3-6,8-11H/t3-,4-,5+,6+/m1/s1 |
| InChIKey | AGYFAAMKMRARQB-ZXXMMSQZSA-N |
| XLogP | -1.28 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.04 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |