C7H10O4 — CID 89165205
(3R,4S)-3,4,5-trihydroxycyclohexene-1-carbaldehyde (PubChem CID 89165205) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (3R,4S)-3,4,5-trihydroxycyclohexene-1-carbaldehyde.
| Compound Name | (3R,4S)-3,4,5-trihydroxycyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 89165205 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (3R,4S)-3,4,5-trihydroxycyclohexene-1-carbaldehyde |
| SMILES | O=CC1=C[C@@H](O)[C@@H](O)C(O)C1 |
| InChI | InChI=1S/C7H10O4/c8-3-4-1-5(9)7(11)6(10)2-4/h1,3,5-7,9-11H,2H2/t5-,6?,7-/m1/s1 |
| InChIKey | UZGBQMZZECVISB-YFBHCESUSA-N |
| XLogP | -1.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|