C7H9O5- — CID 7057976
(3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate (PubChem CID 7057976) has the molecular formula C7H9O5- and a molecular weight of 173.14 g/mol. Its IUPAC name is (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate.
| Compound Name | (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 7057976 |
| Molecular Formula | C7H9O5- |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate |
| SMILES | O=C([O-])C1=C[C@@H](O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/p-1/t4-,5-,6-/m1/s1 |
| InChIKey | JXOHGGNKMLTUBP-HSUXUTPPSA-M |
| XLogP | -2.85 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |