C7H7O5- — CID 5460360
(4S,5R)-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate (PubChem CID 5460360) has the molecular formula C7H7O5- and a molecular weight of 171.13 g/mol. Its IUPAC name is (4S,5R)-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate.
| Compound Name | (4S,5R)-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 5460360 |
| Molecular Formula | C7H7O5- |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | (4S,5R)-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate |
| SMILES | O=C([O-])C1=CC(=O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H8O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,5-6,9-10H,2H2,(H,11,12)/p-1/t5-,6-/m1/s1 |
| InChIKey | SLWWJZMPHJJOPH-PHDIDXHHSA-M |
| XLogP | -2.64 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |