C7H10O5 — CID 10986763
(3S,4R,5S)-3,4,5-trihydroxycyclohexene-1-carboxylic acid (PubChem CID 10986763) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is (3S,4R,5S)-3,4,5-trihydroxycyclohexene-1-carboxylic acid.
| Compound Name | (3S,4R,5S)-3,4,5-trihydroxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 10986763 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (3S,4R,5S)-3,4,5-trihydroxycyclohexene-1-carboxylic acid |
| SMILES | O=C(O)C1=C[C@H](O)[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m0/s1 |
| InChIKey | JXOHGGNKMLTUBP-ZLUOBGJFSA-N |
| XLogP | -1.52 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |