C14H10BrF6N5 — CID 87885354
5-bromo-6-(2,4,6-trifluorophenyl)-4-[(2S)-1,1,1-trifluoropropan-2-yl]-7H-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 87885354) has the molecular formula C14H10BrF6N5 and a molecular weight of 442.16 g/mol. Its IUPAC name is 5-bromo-6-(2,4,6-trifluorophenyl)-4-[(2S)-1,1,1-trifluoropropan-2-yl]-7H-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-bromo-6-(2,4,6-trifluorophenyl)-4-[(2S)-1,1,1-trifluoropropan-2-yl]-7H-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 87885354 |
| Molecular Formula | C14H10BrF6N5 |
| Molecular Weight | 442.16 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 5-bromo-6-(2,4,6-trifluorophenyl)-4-[(2S)-1,1,1-trifluoropropan-2-yl]-7H-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](N1C(Br)=C(c2c(F)cc(F)cc2F)C(N)n2ncnc21)C(F)(F)F |
| InChI | InChI=1S/C14H10BrF6N5/c1-5(14(19,20)21)25-11(15)10(12(22)26-13(25)23-4-24-26)9-7(17)2-6(16)3-8(9)18/h2-5,12H,22H2,1H3/t5-,12?/m0/s1 |
| InChIKey | UQLZZGUJTOZQCB-XHBICQFHSA-N |
| XLogP | 3.69 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.16 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|