About (4R)-4-methoxyoxan-3-one
(4R)-4-methoxyoxan-3-one (PubChem CID 131972090) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (4R)-4-methoxyoxan-3-one.
Molecular Properties
| Compound Name | (4R)-4-methoxyoxan-3-one |
| PubChem CID | 131972090 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (4R)-4-methoxyoxan-3-one |
| SMILES | CO[C@@H]1CCOCC1=O |
| InChI | InChI=1S/C6H10O3/c1-8-6-2-3-9-4-5(6)7/h6H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | HAYLWHOTGGIJEP-ZCFIWIBFSA-N |
| XLogP | -0.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-methoxyoxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-methoxyoxan-3-one?
The IUPAC name of (4R)-4-methoxyoxan-3-one (CID 131972090) is (4R)-4-methoxyoxan-3-one.
What is the SMILES notation for (4R)-4-methoxyoxan-3-one?
The canonical SMILES for (4R)-4-methoxyoxan-3-one is CO[C@@H]1CCOCC1=O.
What is the InChIKey of (4R)-4-methoxyoxan-3-one?
The InChIKey is HAYLWHOTGGIJEP-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H10O3/c1-8-6-2-3-9-4-5(6)7/h6H,2-4H2,1H3/t6-/m1/s1.
What are the key properties of (4R)-4-methoxyoxan-3-one?
(4R)-4-methoxyoxan-3-one has a molecular weight of 130.14 g/mol, XLogP of -0.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-methoxyoxan-3-one is sourced from PubChem (CID 131972090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).