C13H20N2O2S — CID 13197230
N-[4-(2-ethyl-2-methyloxan-4-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 13197230) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N-[4-(2-ethyl-2-methyloxan-4-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-(2-ethyl-2-methyloxan-4-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 13197230 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[4-(2-ethyl-2-methyloxan-4-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCC1(C)CC(c2csc(NC(C)=O)n2)CCO1 |
| InChI | InChI=1S/C13H20N2O2S/c1-4-13(3)7-10(5-6-17-13)11-8-18-12(15-11)14-9(2)16/h8,10H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | YTPMXIQWRFIFOR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |